C11H30O4Si4 — CID 175464343
2-tert-butyl-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 175464343) has the molecular formula C11H30O4Si4 and a molecular weight of 338.70 g/mol. Its IUPAC name is 2-tert-butyl-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2-tert-butyl-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 175464343 |
| Molecular Formula | C11H30O4Si4 |
| Molecular Weight | 338.70 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 2-tert-butyl-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | CC(C)(C)[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C11H30O4Si4/c1-11(2,3)19(10)14-17(6,7)12-16(4,5)13-18(8,9)15-19/h1-10H3 |
| InChIKey | CXFSOOOGJHENGS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.70 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|