C14H21F3N4O2 — CID 175464397
1-hexan-2-yl-3-[[4-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]methyl]urea (PubChem CID 175464397) has the molecular formula C14H21F3N4O2 and a molecular weight of 334.34 g/mol. Its IUPAC name is 1-hexan-2-yl-3-[[4-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]methyl]urea.
| Compound Name | 1-hexan-2-yl-3-[[4-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]methyl]urea |
|---|---|
| PubChem CID | 175464397 |
| Molecular Formula | C14H21F3N4O2 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 1-hexan-2-yl-3-[[4-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]methyl]urea |
| SMILES | CCCCC(C)NC(=O)NCc1nccc(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C14H21F3N4O2/c1-3-4-5-10(2)20-13(22)19-8-11-18-7-6-12(21-11)23-9-14(15,16)17/h6-7,10H,3-5,8-9H2,1-2H3,(H2,19,20,22) |
| InChIKey | CFVNPAWFYPRUJK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |