C15H23F3N4O2 — CID 175464447
1-hexan-2-yl-3-[1-[6-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]ethyl]urea (PubChem CID 175464447) has the molecular formula C15H23F3N4O2 and a molecular weight of 348.37 g/mol. Its IUPAC name is 1-hexan-2-yl-3-[1-[6-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]ethyl]urea.
| Compound Name | 1-hexan-2-yl-3-[1-[6-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]ethyl]urea |
|---|---|
| PubChem CID | 175464447 |
| Molecular Formula | C15H23F3N4O2 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 1-hexan-2-yl-3-[1-[6-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]ethyl]urea |
| SMILES | CCCCC(C)NC(=O)NC(C)c1cc(OCC(F)(F)F)ncn1 |
| InChI | InChI=1S/C15H23F3N4O2/c1-4-5-6-10(2)21-14(23)22-11(3)12-7-13(20-9-19-12)24-8-15(16,17)18/h7,9-11H,4-6,8H2,1-3H3,(H2,21,22,23) |
| InChIKey | LFLJSRDDWRZSFH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |