C16H25F3N4O2 — CID 175464601
1-heptan-2-yl-3-[(1R)-1-[6-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]ethyl]urea (PubChem CID 175464601) has the molecular formula C16H25F3N4O2 and a molecular weight of 362.40 g/mol. Its IUPAC name is 1-heptan-2-yl-3-[(1R)-1-[6-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]ethyl]urea.
| Compound Name | 1-heptan-2-yl-3-[(1R)-1-[6-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]ethyl]urea |
|---|---|
| PubChem CID | 175464601 |
| Molecular Formula | C16H25F3N4O2 |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 1-heptan-2-yl-3-[(1R)-1-[6-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]ethyl]urea |
| SMILES | CCCCCC(C)NC(=O)N[C@H](C)c1cc(OCC(F)(F)F)ncn1 |
| InChI | InChI=1S/C16H25F3N4O2/c1-4-5-6-7-11(2)22-15(24)23-12(3)13-8-14(21-10-20-13)25-9-16(17,18)19/h8,10-12H,4-7,9H2,1-3H3,(H2,22,23,24)/t11?,12-/m1/s1 |
| InChIKey | VWAZOTHUSJDDKE-PIJUOVFKSA-N |
| XLogP | 3.75 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|