About potassium;5-chloro-4-hydroxy-1H-pyridin-2-one;hydride
potassium;5-chloro-4-hydroxy-1H-pyridin-2-one;hydride (PubChem CID 175464848) has the molecular formula C5H5ClKNO2
and a molecular weight of 185.65 g/mol. Its IUPAC name is potassium;5-chloro-4-hydroxy-1H-pyridin-2-one;hydride.
Molecular Properties
| Compound Name | potassium;5-chloro-4-hydroxy-1H-pyridin-2-one;hydride |
| PubChem CID | 175464848 |
| Molecular Formula | C5H5ClKNO2 |
| Molecular Weight | 185.65 g/mol |
| Exact Mass | 184.96 |
| IUPAC Name | potassium;5-chloro-4-hydroxy-1H-pyridin-2-one;hydride |
| SMILES | O=c1cc(O)c(Cl)c[nH]1.[H-].[K+] |
| InChI | InChI=1S/C5H4ClNO2.K.H/c6-3-2-7-5(9)1-4(3)8;;/h1-2H,(H2,7,8,9);;/q;+1;-1 |
| InChIKey | GRBMCPJMVIFHPS-UHFFFAOYSA-N |
| XLogP | -2.15 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.65 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze potassium;5-chloro-4-hydroxy-1H-pyridin-2-one;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;5-chloro-4-hydroxy-1H-pyridin-2-one;hydride?
The IUPAC name of potassium;5-chloro-4-hydroxy-1H-pyridin-2-one;hydride (CID 175464848) is potassium;5-chloro-4-hydroxy-1H-pyridin-2-one;hydride.
What is the SMILES notation for potassium;5-chloro-4-hydroxy-1H-pyridin-2-one;hydride?
The canonical SMILES for potassium;5-chloro-4-hydroxy-1H-pyridin-2-one;hydride is O=c1cc(O)c(Cl)c[nH]1.[H-].[K+].
What is the InChIKey of potassium;5-chloro-4-hydroxy-1H-pyridin-2-one;hydride?
The InChIKey is GRBMCPJMVIFHPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4ClNO2.K.H/c6-3-2-7-5(9)1-4(3)8;;/h1-2H,(H2,7,8,9);;/q;+1;-1.
What are the key properties of potassium;5-chloro-4-hydroxy-1H-pyridin-2-one;hydride?
potassium;5-chloro-4-hydroxy-1H-pyridin-2-one;hydride has a molecular weight of 185.65 g/mol, XLogP of -2.15, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;5-chloro-4-hydroxy-1H-pyridin-2-one;hydride is sourced from PubChem (CID 175464848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).