C10H7BrF3N — CID 175467087
7-bromo-3-(1,2,2-trifluoroethyl)-1H-indole (PubChem CID 175467087) has the molecular formula C10H7BrF3N and a molecular weight of 278.07 g/mol. Its IUPAC name is 7-bromo-3-(1,2,2-trifluoroethyl)-1H-indole.
| Compound Name | 7-bromo-3-(1,2,2-trifluoroethyl)-1H-indole |
|---|---|
| PubChem CID | 175467087 |
| Molecular Formula | C10H7BrF3N |
| Molecular Weight | 278.07 g/mol |
| Exact Mass | 276.97 |
| IUPAC Name | 7-bromo-3-(1,2,2-trifluoroethyl)-1H-indole |
| SMILES | FC(F)C(F)c1c[nH]c2c(Br)cccc12 |
| InChI | InChI=1S/C10H7BrF3N/c11-7-3-1-2-5-6(4-15-9(5)7)8(12)10(13)14/h1-4,8,10,15H |
| InChIKey | HKWQRRHXFBZDKA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.07 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |