About ethyl hydrogen sulfate;3-ethyl-1-methoxycyclohexa-2,4-dien-1-ol;2H-oxazine
ethyl hydrogen sulfate;3-ethyl-1-methoxycyclohexa-2,4-dien-1-ol;2H-oxazine (PubChem CID 175467699) has the molecular formula C15H25NO7S
and a molecular weight of 363.43 g/mol. Its IUPAC name is ethyl hydrogen sulfate;3-ethyl-1-methoxycyclohexa-2,4-dien-1-ol;2H-oxazine.
Molecular Properties
| Compound Name | ethyl hydrogen sulfate;3-ethyl-1-methoxycyclohexa-2,4-dien-1-ol;2H-oxazine |
| PubChem CID | 175467699 |
| Molecular Formula | C15H25NO7S |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | ethyl hydrogen sulfate;3-ethyl-1-methoxycyclohexa-2,4-dien-1-ol;2H-oxazine |
| SMILES | C1=CNOC=C1.CCC1=CC(O)(OC)CC=C1.CCOS(=O)(=O)O |
| InChI | InChI=1S/C9H14O2.C4H5NO.C2H6O4S/c1-3-8-5-4-6-9(10,7-8)11-2;1-2-4-6-5-3-1;1-2-6-7(3,4)5/h4-5,7,10H,3,6H2,1-2H3;1-5H;2H2,1H3,(H,3,4,5) |
| InChIKey | ZQKSQDIMNPPIRW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl hydrogen sulfate;3-ethyl-1-methoxycyclohexa-2,4-dien-1-ol;2H-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl hydrogen sulfate;3-ethyl-1-methoxycyclohexa-2,4-dien-1-ol;2H-oxazine?
The IUPAC name of ethyl hydrogen sulfate;3-ethyl-1-methoxycyclohexa-2,4-dien-1-ol;2H-oxazine (CID 175467699) is ethyl hydrogen sulfate;3-ethyl-1-methoxycyclohexa-2,4-dien-1-ol;2H-oxazine.
What is the SMILES notation for ethyl hydrogen sulfate;3-ethyl-1-methoxycyclohexa-2,4-dien-1-ol;2H-oxazine?
The canonical SMILES for ethyl hydrogen sulfate;3-ethyl-1-methoxycyclohexa-2,4-dien-1-ol;2H-oxazine is C1=CNOC=C1.CCC1=CC(O)(OC)CC=C1.CCOS(=O)(=O)O.
What is the InChIKey of ethyl hydrogen sulfate;3-ethyl-1-methoxycyclohexa-2,4-dien-1-ol;2H-oxazine?
The InChIKey is ZQKSQDIMNPPIRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2.C4H5NO.C2H6O4S/c1-3-8-5-4-6-9(10,7-8)11-2;1-2-4-6-5-3-1;1-2-6-7(3,4)5/h4-5,7,10H,3,6H2,1-2H3;1-5H;2H2,1H3,(H,3,4,5).
What are the key properties of ethyl hydrogen sulfate;3-ethyl-1-methoxycyclohexa-2,4-dien-1-ol;2H-oxazine?
ethyl hydrogen sulfate;3-ethyl-1-methoxycyclohexa-2,4-dien-1-ol;2H-oxazine has a molecular weight of 363.43 g/mol, XLogP of 1.99, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl hydrogen sulfate;3-ethyl-1-methoxycyclohexa-2,4-dien-1-ol;2H-oxazine is sourced from PubChem (CID 175467699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).