C34H34BrFN6O — CID 175467773
4-(3-bromo-2-fluoroanilino)-N-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]quinazoline-6-carboxamide (PubChem CID 175467773) has the molecular formula C34H34BrFN6O and a molecular weight of 641.59 g/mol. Its IUPAC name is 4-(3-bromo-2-fluoroanilino)-N-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]quinazoline-6-carboxamide.
| Compound Name | 4-(3-bromo-2-fluoroanilino)-N-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]quinazoline-6-carboxamide |
|---|---|
| PubChem CID | 175467773 |
| Molecular Formula | C34H34BrFN6O |
| Molecular Weight | 641.59 g/mol |
| Exact Mass | 640.20 |
| IUPAC Name | 4-(3-bromo-2-fluoroanilino)-N-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]quinazoline-6-carboxamide |
| SMILES | O=C(NCCCCCCNc1c2c(nc3ccccc13)CCCC2)c1ccc2ncnc(Nc3cccc(Br)c3F)c2c1 |
| InChI | InChI=1S/C34H34BrFN6O/c35-26-12-9-15-30(31(26)36)42-33-25-20-22(16-17-27(25)39-21-40-33)34(43)38-19-8-2-1-7-18-37-32-23-10-3-5-13-28(23)41-29-14-6-4-11-24(29)32/h3,5,9-10,12-13,15-17,20-21H,1-2,4,6-8,11,14,18-19H2,(H,37,41)(H,38,43)(H,39,40,42) |
| InChIKey | BPKVGSVJJYMQBZ-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.59 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|