C17H13ClFN3O4 — CID 175467828
2-[(4-chloro-2-fluoro-3-phenyl-1,2,4-oxadiazolidin-5-yl)methoxy]isoindole-1,3-dione (PubChem CID 175467828) has the molecular formula C17H13ClFN3O4 and a molecular weight of 377.76 g/mol. Its IUPAC name is 2-[(4-chloro-2-fluoro-3-phenyl-1,2,4-oxadiazolidin-5-yl)methoxy]isoindole-1,3-dione.
| Compound Name | 2-[(4-chloro-2-fluoro-3-phenyl-1,2,4-oxadiazolidin-5-yl)methoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 175467828 |
| Molecular Formula | C17H13ClFN3O4 |
| Molecular Weight | 377.76 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 2-[(4-chloro-2-fluoro-3-phenyl-1,2,4-oxadiazolidin-5-yl)methoxy]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1OCC1ON(F)C(c2ccccc2)N1Cl |
| InChI | InChI=1S/C17H13ClFN3O4/c18-20-14(26-22(19)15(20)11-6-2-1-3-7-11)10-25-21-16(23)12-8-4-5-9-13(12)17(21)24/h1-9,14-15H,10H2 |
| InChIKey | HOSWQMWEFOJDTL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.76 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|