C19H36O10Si — CID 175468444
[diacetyloxy(1,1,2-tripropoxypropyl)silyl] 2-methoxyacetate (PubChem CID 175468444) has the molecular formula C19H36O10Si and a molecular weight of 452.57 g/mol. Its IUPAC name is [diacetyloxy(1,1,2-tripropoxypropyl)silyl] 2-methoxyacetate.
| Compound Name | [diacetyloxy(1,1,2-tripropoxypropyl)silyl] 2-methoxyacetate |
|---|---|
| PubChem CID | 175468444 |
| Molecular Formula | C19H36O10Si |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | [diacetyloxy(1,1,2-tripropoxypropyl)silyl] 2-methoxyacetate |
| SMILES | CCCOC(C)C(OCCC)(OCCC)[Si](OC(C)=O)(OC(C)=O)OC(=O)COC |
| InChI | InChI=1S/C19H36O10Si/c1-8-11-24-15(4)19(25-12-9-2,26-13-10-3)30(27-16(5)20,28-17(6)21)29-18(22)14-23-7/h15H,8-14H2,1-7H3 |
| InChIKey | LWDPTVJCMBBYKB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|