C30H30Cl2FN5O — CID 175468478
3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-[1-[(1R)-1-phenylprop-2-enyl]piperidin-4-yl]pyrazol-4-yl]pyridin-2-amine (PubChem CID 175468478) has the molecular formula C30H30Cl2FN5O and a molecular weight of 566.51 g/mol. Its IUPAC name is 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-[1-[(1R)-1-phenylprop-2-enyl]piperidin-4-yl]pyrazol-4-yl]pyridin-2-amine.
| Compound Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-[1-[(1R)-1-phenylprop-2-enyl]piperidin-4-yl]pyrazol-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 175468478 |
| Molecular Formula | C30H30Cl2FN5O |
| Molecular Weight | 566.51 g/mol |
| Exact Mass | 565.18 |
| IUPAC Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-[1-[(1R)-1-phenylprop-2-enyl]piperidin-4-yl]pyrazol-4-yl]pyridin-2-amine |
| SMILES | C=C[C@H](c1ccccc1)N1CCC(n2cc(-c3cnc(N)c(OC(C)c4c(Cl)ccc(F)c4Cl)c3)cn2)CC1 |
| InChI | InChI=1S/C30H30Cl2FN5O/c1-3-26(20-7-5-4-6-8-20)37-13-11-23(12-14-37)38-18-22(17-36-38)21-15-27(30(34)35-16-21)39-19(2)28-24(31)9-10-25(33)29(28)32/h3-10,15-19,23,26H,1,11-14H2,2H3,(H2,34,35)/t19?,26-/m1/s1 |
| InChIKey | DCRCAJWNGPCYJW-COTLDPOVSA-N |
| XLogP | 7.68 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.51 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|