About [ethoxy(octan-3-yloxy)phosphoryl] prop-2-eneperoxoate
[ethoxy(octan-3-yloxy)phosphoryl] prop-2-eneperoxoate (PubChem CID 175468613) has the molecular formula C13H25O6P
and a molecular weight of 308.31 g/mol. Its IUPAC name is [ethoxy(octan-3-yloxy)phosphoryl] prop-2-eneperoxoate.
Molecular Properties
| Compound Name | [ethoxy(octan-3-yloxy)phosphoryl] prop-2-eneperoxoate |
| PubChem CID | 175468613 |
| Molecular Formula | C13H25O6P |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | [ethoxy(octan-3-yloxy)phosphoryl] prop-2-eneperoxoate |
| SMILES | C=CC(=O)OOP(=O)(OCC)OC(CC)CCCCC |
| InChI | InChI=1S/C13H25O6P/c1-5-9-10-11-12(6-2)18-20(15,16-8-4)19-17-13(14)7-3/h7,12H,3,5-6,8-11H2,1-2,4H3 |
| InChIKey | NBZGWZMDTQTPPQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [ethoxy(octan-3-yloxy)phosphoryl] prop-2-eneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [ethoxy(octan-3-yloxy)phosphoryl] prop-2-eneperoxoate?
The IUPAC name of [ethoxy(octan-3-yloxy)phosphoryl] prop-2-eneperoxoate (CID 175468613) is [ethoxy(octan-3-yloxy)phosphoryl] prop-2-eneperoxoate.
What is the SMILES notation for [ethoxy(octan-3-yloxy)phosphoryl] prop-2-eneperoxoate?
The canonical SMILES for [ethoxy(octan-3-yloxy)phosphoryl] prop-2-eneperoxoate is C=CC(=O)OOP(=O)(OCC)OC(CC)CCCCC.
What is the InChIKey of [ethoxy(octan-3-yloxy)phosphoryl] prop-2-eneperoxoate?
The InChIKey is NBZGWZMDTQTPPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25O6P/c1-5-9-10-11-12(6-2)18-20(15,16-8-4)19-17-13(14)7-3/h7,12H,3,5-6,8-11H2,1-2,4H3.
What are the key properties of [ethoxy(octan-3-yloxy)phosphoryl] prop-2-eneperoxoate?
[ethoxy(octan-3-yloxy)phosphoryl] prop-2-eneperoxoate has a molecular weight of 308.31 g/mol, XLogP of 4.17, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [ethoxy(octan-3-yloxy)phosphoryl] prop-2-eneperoxoate is sourced from PubChem (CID 175468613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).