C24H42O — CID 175468869
2-[2-(cyclopenten-1-yl)-1,2,3,3-tetramethylcyclooctyl]oxocane (PubChem CID 175468869) has the molecular formula C24H42O and a molecular weight of 346.60 g/mol. Its IUPAC name is 2-[2-(cyclopenten-1-yl)-1,2,3,3-tetramethylcyclooctyl]oxocane.
| Compound Name | 2-[2-(cyclopenten-1-yl)-1,2,3,3-tetramethylcyclooctyl]oxocane |
|---|---|
| PubChem CID | 175468869 |
| Molecular Formula | C24H42O |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 346.32 |
| IUPAC Name | 2-[2-(cyclopenten-1-yl)-1,2,3,3-tetramethylcyclooctyl]oxocane |
| SMILES | CC1(C)CCCCCC(C)(C2CCCCCCO2)C1(C)C1=CCCC1 |
| InChI | InChI=1S/C24H42O/c1-22(2)17-11-7-12-18-23(3,21-16-8-5-6-13-19-25-21)24(22,4)20-14-9-10-15-20/h14,21H,5-13,15-19H2,1-4H3 |
| InChIKey | DHNCRXLKHKWEEJ-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|