C48H42O36 — CID 175469455
bis(6-ethoxycarbonylbenzene-1,2,3,4,5-pentacarboxylic acid);5-ethoxycarbonyl-6-hexoxycarbonylbenzene-1,2,3,4-tetracarboxylic acid (PubChem CID 175469455) has the molecular formula C48H42O36 and a molecular weight of 1194.83 g/mol. Its IUPAC name is bis(6-ethoxycarbonylbenzene-1,2,3,4,5-pentacarboxylic acid);5-ethoxycarbonyl-6-hexoxycarbonylbenzene-1,2,3,4-tetracarboxylic acid.
| Compound Name | bis(6-ethoxycarbonylbenzene-1,2,3,4,5-pentacarboxylic acid);5-ethoxycarbonyl-6-hexoxycarbonylbenzene-1,2,3,4-tetracarboxylic acid |
|---|---|
| PubChem CID | 175469455 |
| Molecular Formula | C48H42O36 |
| Molecular Weight | 1194.83 g/mol |
| Exact Mass | 1194.15 |
| IUPAC Name | bis(6-ethoxycarbonylbenzene-1,2,3,4,5-pentacarboxylic acid);5-ethoxycarbonyl-6-hexoxycarbonylbenzene-1,2,3,4-tetracarboxylic acid |
| SMILES | CCCCCCOC(=O)c1c(C(=O)O)c(C(=O)O)c(C(=O)O)c(C(=O)O)c1C(=O)OCC.CCOC(=O)c1c(C(=O)O)c(C(=O)O)c(C(=O)O)c(C(=O)O)c1C(=O)O.CCOC(=O)c1c(C(=O)O)c(C(=O)O)c(C(=O)O)c(C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C20H22O12.2C14H10O12/c1-3-5-6-7-8-32-20(30)14-12(18(27)28)10(16(23)24)9(15(21)22)11(17(25)26)13(14)19(29)31-4-2;2*1-2-26-14(25)8-6(12(21)22)4(10(17)18)3(9(15)16)5(11(19)20)7(8)13(23)24/h3-8H2,1-2H3,(H,21,22)(H,23,24)(H,25,26)(H,27,28);2*2H2,1H3,(H,15,16)(H,17,18)(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | WELAWYSFXNGOGJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 627.40 Ų |
| H-Bond Donors | 14 |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 84 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1194.83 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 14 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|