C15H15F17OSi — CID 175469731
6-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-2,2,6-trimethyloxasilinane (PubChem CID 175469731) has the molecular formula C15H15F17OSi and a molecular weight of 562.34 g/mol. Its IUPAC name is 6-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-2,2,6-trimethyloxasilinane.
| Compound Name | 6-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-2,2,6-trimethyloxasilinane |
|---|---|
| PubChem CID | 175469731 |
| Molecular Formula | C15H15F17OSi |
| Molecular Weight | 562.34 g/mol |
| Exact Mass | 562.06 |
| IUPAC Name | 6-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-2,2,6-trimethyloxasilinane |
| SMILES | CC1(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCC[Si](C)(C)O1 |
| InChI | InChI=1S/C15H15F17OSi/c1-7(5-4-6-34(2,3)33-7)8(16,17)9(18,19)10(20,21)11(22,23)12(24,25)13(26,27)14(28,29)15(30,31)32/h4-6H2,1-3H3 |
| InChIKey | JKUZJCDIZOXNFZ-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.34 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|