About 4-(1-fluoroethyl)-1,3-dioxetan-2-one
4-(1-fluoroethyl)-1,3-dioxetan-2-one (PubChem CID 175470122) has the molecular formula C4H5FO3
and a molecular weight of 120.08 g/mol. Its IUPAC name is 4-(1-fluoroethyl)-1,3-dioxetan-2-one.
Molecular Properties
| Compound Name | 4-(1-fluoroethyl)-1,3-dioxetan-2-one |
| PubChem CID | 175470122 |
| Molecular Formula | C4H5FO3 |
| Molecular Weight | 120.08 g/mol |
| Exact Mass | 120.02 |
| IUPAC Name | 4-(1-fluoroethyl)-1,3-dioxetan-2-one |
| SMILES | CC(F)C1OC(=O)O1 |
| InChI | InChI=1S/C4H5FO3/c1-2(5)3-7-4(6)8-3/h2-3H,1H3 |
| InChIKey | PPIYIIQCBURDRR-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.08 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1-fluoroethyl)-1,3-dioxetan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-fluoroethyl)-1,3-dioxetan-2-one?
The IUPAC name of 4-(1-fluoroethyl)-1,3-dioxetan-2-one (CID 175470122) is 4-(1-fluoroethyl)-1,3-dioxetan-2-one.
What is the SMILES notation for 4-(1-fluoroethyl)-1,3-dioxetan-2-one?
The canonical SMILES for 4-(1-fluoroethyl)-1,3-dioxetan-2-one is CC(F)C1OC(=O)O1.
What is the InChIKey of 4-(1-fluoroethyl)-1,3-dioxetan-2-one?
The InChIKey is PPIYIIQCBURDRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5FO3/c1-2(5)3-7-4(6)8-3/h2-3H,1H3.
What are the key properties of 4-(1-fluoroethyl)-1,3-dioxetan-2-one?
4-(1-fluoroethyl)-1,3-dioxetan-2-one has a molecular weight of 120.08 g/mol, XLogP of 0.84, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-fluoroethyl)-1,3-dioxetan-2-one is sourced from PubChem (CID 175470122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).