About 6-hydroxynaphthalene-2-sulfonic acid;nickel
6-hydroxynaphthalene-2-sulfonic acid;nickel (PubChem CID 175470147) has the molecular formula C10H8NiO4S
and a molecular weight of 282.93 g/mol. Its IUPAC name is 6-hydroxynaphthalene-2-sulfonic acid;nickel.
Molecular Properties
| Compound Name | 6-hydroxynaphthalene-2-sulfonic acid;nickel |
| PubChem CID | 175470147 |
| Molecular Formula | C10H8NiO4S |
| Molecular Weight | 282.93 g/mol |
| Exact Mass | 281.95 |
| IUPAC Name | 6-hydroxynaphthalene-2-sulfonic acid;nickel |
| SMILES | O=S(=O)(O)c1ccc2cc(O)ccc2c1.[Ni] |
| InChI | InChI=1S/C10H8O4S.Ni/c11-9-3-1-8-6-10(15(12,13)14)4-2-7(8)5-9;/h1-6,11H,(H,12,13,14); |
| InChIKey | SYHNJWDPKJNIDB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.93 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxynaphthalene-2-sulfonic acid;nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxynaphthalene-2-sulfonic acid;nickel?
The IUPAC name of 6-hydroxynaphthalene-2-sulfonic acid;nickel (CID 175470147) is 6-hydroxynaphthalene-2-sulfonic acid;nickel.
What is the SMILES notation for 6-hydroxynaphthalene-2-sulfonic acid;nickel?
The canonical SMILES for 6-hydroxynaphthalene-2-sulfonic acid;nickel is O=S(=O)(O)c1ccc2cc(O)ccc2c1.[Ni].
What is the InChIKey of 6-hydroxynaphthalene-2-sulfonic acid;nickel?
The InChIKey is SYHNJWDPKJNIDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O4S.Ni/c11-9-3-1-8-6-10(15(12,13)14)4-2-7(8)5-9;/h1-6,11H,(H,12,13,14);.
What are the key properties of 6-hydroxynaphthalene-2-sulfonic acid;nickel?
6-hydroxynaphthalene-2-sulfonic acid;nickel has a molecular weight of 282.93 g/mol, XLogP of 1.79, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxynaphthalene-2-sulfonic acid;nickel is sourced from PubChem (CID 175470147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).