About tricyclo[5.2.1.02,6]deca-2,4-dien-8-ol
tricyclo[5.2.1.02,6]deca-2,4-dien-8-ol (PubChem CID 175470374) has the molecular formula C10H12O
and a molecular weight of 148.21 g/mol. Its IUPAC name is tricyclo[5.2.1.02,6]deca-2,4-dien-8-ol.
Molecular Properties
| Compound Name | tricyclo[5.2.1.02,6]deca-2,4-dien-8-ol |
| PubChem CID | 175470374 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | tricyclo[5.2.1.02,6]deca-2,4-dien-8-ol |
| SMILES | OC1CC2CC1C1C=CC=C21 |
| InChI | InChI=1S/C10H12O/c11-10-5-6-4-9(10)8-3-1-2-7(6)8/h1-3,6,8-11H,4-5H2 |
| InChIKey | JITFJEYFLLFQII-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze tricyclo[5.2.1.02,6]deca-2,4-dien-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[5.2.1.02,6]deca-2,4-dien-8-ol?
The IUPAC name of tricyclo[5.2.1.02,6]deca-2,4-dien-8-ol (CID 175470374) is tricyclo[5.2.1.02,6]deca-2,4-dien-8-ol.
What is the SMILES notation for tricyclo[5.2.1.02,6]deca-2,4-dien-8-ol?
The canonical SMILES for tricyclo[5.2.1.02,6]deca-2,4-dien-8-ol is OC1CC2CC1C1C=CC=C21.
What is the InChIKey of tricyclo[5.2.1.02,6]deca-2,4-dien-8-ol?
The InChIKey is JITFJEYFLLFQII-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O/c11-10-5-6-4-9(10)8-3-1-2-7(6)8/h1-3,6,8-11H,4-5H2.
What are the key properties of tricyclo[5.2.1.02,6]deca-2,4-dien-8-ol?
tricyclo[5.2.1.02,6]deca-2,4-dien-8-ol has a molecular weight of 148.21 g/mol, XLogP of 1.50, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[5.2.1.02,6]deca-2,4-dien-8-ol is sourced from PubChem (CID 175470374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).