C10H11F3N2O2 — CID 175470384
6-(1,2,2-trifluoroethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-3-carboxylic acid (PubChem CID 175470384) has the molecular formula C10H11F3N2O2 and a molecular weight of 248.20 g/mol. Its IUPAC name is 6-(1,2,2-trifluoroethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-3-carboxylic acid.
| Compound Name | 6-(1,2,2-trifluoroethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 175470384 |
| Molecular Formula | C10H11F3N2O2 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 6-(1,2,2-trifluoroethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ncc2n1CC(C(F)C(F)F)CC2 |
| InChI | InChI=1S/C10H11F3N2O2/c11-7(8(12)13)5-1-2-6-3-14-9(10(16)17)15(6)4-5/h3,5,7-8H,1-2,4H2,(H,16,17) |
| InChIKey | WTDWUDCMKOLYFI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |