C9H9F3N2O3 — CID 175470404
5-(1,2,2-trifluoroethyl)-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxylic acid (PubChem CID 175470404) has the molecular formula C9H9F3N2O3 and a molecular weight of 250.18 g/mol. Its IUPAC name is 5-(1,2,2-trifluoroethyl)-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxylic acid.
| Compound Name | 5-(1,2,2-trifluoroethyl)-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 175470404 |
| Molecular Formula | C9H9F3N2O3 |
| Molecular Weight | 250.18 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 5-(1,2,2-trifluoroethyl)-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1n[nH]c2c1CC(C(F)C(F)F)OC2 |
| InChI | InChI=1S/C9H9F3N2O3/c10-6(8(11)12)5-1-3-4(2-17-5)13-14-7(3)9(15)16/h5-6,8H,1-2H2,(H,13,14)(H,15,16) |
| InChIKey | PZZVFYVHPQVWES-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.18 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |