About cyclohexa-2,5-diene-1,4-dione;propan-2-amine
cyclohexa-2,5-diene-1,4-dione;propan-2-amine (PubChem CID 175470466) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is cyclohexa-2,5-diene-1,4-dione;propan-2-amine.
Molecular Properties
| Compound Name | cyclohexa-2,5-diene-1,4-dione;propan-2-amine |
| PubChem CID | 175470466 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | cyclohexa-2,5-diene-1,4-dione;propan-2-amine |
| SMILES | CC(C)N.O=C1C=CC(=O)C=C1 |
| InChI | InChI=1S/C6H4O2.C3H9N/c7-5-1-2-6(8)4-3-5;1-3(2)4/h1-4H;3H,4H2,1-2H3 |
| InChIKey | KSXHFHQOQFLGKL-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze cyclohexa-2,5-diene-1,4-dione;propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-2,5-diene-1,4-dione;propan-2-amine?
The IUPAC name of cyclohexa-2,5-diene-1,4-dione;propan-2-amine (CID 175470466) is cyclohexa-2,5-diene-1,4-dione;propan-2-amine.
What is the SMILES notation for cyclohexa-2,5-diene-1,4-dione;propan-2-amine?
The canonical SMILES for cyclohexa-2,5-diene-1,4-dione;propan-2-amine is CC(C)N.O=C1C=CC(=O)C=C1.
What is the InChIKey of cyclohexa-2,5-diene-1,4-dione;propan-2-amine?
The InChIKey is KSXHFHQOQFLGKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4O2.C3H9N/c7-5-1-2-6(8)4-3-5;1-3(2)4/h1-4H;3H,4H2,1-2H3.
What are the key properties of cyclohexa-2,5-diene-1,4-dione;propan-2-amine?
cyclohexa-2,5-diene-1,4-dione;propan-2-amine has a molecular weight of 167.21 g/mol, XLogP of 0.60, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-2,5-diene-1,4-dione;propan-2-amine is sourced from PubChem (CID 175470466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).