C17H32N2O2 — CID 175470666
tert-butyl (2S)-5-methyl-2-(1-methylpiperidin-3-yl)piperidine-1-carboxylate (PubChem CID 175470666) has the molecular formula C17H32N2O2 and a molecular weight of 296.45 g/mol. Its IUPAC name is tert-butyl (2S)-5-methyl-2-(1-methylpiperidin-3-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-5-methyl-2-(1-methylpiperidin-3-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175470666 |
| Molecular Formula | C17H32N2O2 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | tert-butyl (2S)-5-methyl-2-(1-methylpiperidin-3-yl)piperidine-1-carboxylate |
| SMILES | CC1CC[C@@H](C2CCCN(C)C2)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H32N2O2/c1-13-8-9-15(14-7-6-10-18(5)12-14)19(11-13)16(20)21-17(2,3)4/h13-15H,6-12H2,1-5H3/t13?,14?,15-/m0/s1 |
| InChIKey | IQNIMCDFPPAGBR-NRXISQOPSA-N |
| XLogP | 3.36 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |