C8H10F3N3O3 — CID 175471466
4,6-dimethoxy-5-(2,2,2-trifluoroethoxy)pyrimidin-2-amine (PubChem CID 175471466) has the molecular formula C8H10F3N3O3 and a molecular weight of 253.18 g/mol. Its IUPAC name is 4,6-dimethoxy-5-(2,2,2-trifluoroethoxy)pyrimidin-2-amine.
| Compound Name | 4,6-dimethoxy-5-(2,2,2-trifluoroethoxy)pyrimidin-2-amine |
|---|---|
| PubChem CID | 175471466 |
| Molecular Formula | C8H10F3N3O3 |
| Molecular Weight | 253.18 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 4,6-dimethoxy-5-(2,2,2-trifluoroethoxy)pyrimidin-2-amine |
| SMILES | COc1nc(N)nc(OC)c1OCC(F)(F)F |
| InChI | InChI=1S/C8H10F3N3O3/c1-15-5-4(17-3-8(9,10)11)6(16-2)14-7(12)13-5/h3H2,1-2H3,(H2,12,13,14) |
| InChIKey | VJXAANZFVJIZRS-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 79.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.18 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |