About 5-(bromomethyl)-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid
5-(bromomethyl)-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 175471571) has the molecular formula C9H10BrFO2
and a molecular weight of 249.08 g/mol. Its IUPAC name is 5-(bromomethyl)-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 5-(bromomethyl)-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid |
| PubChem CID | 175471571 |
| Molecular Formula | C9H10BrFO2 |
| Molecular Weight | 249.08 g/mol |
| Exact Mass | 247.98 |
| IUPAC Name | 5-(bromomethyl)-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid |
| SMILES | CC1(CBr)CC(C(=O)O)=CC=C1F |
| InChI | InChI=1S/C9H10BrFO2/c1-9(5-10)4-6(8(12)13)2-3-7(9)11/h2-3H,4-5H2,1H3,(H,12,13) |
| InChIKey | YOFYDSDGJGHFAO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.08 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(bromomethyl)-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(bromomethyl)-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid?
The IUPAC name of 5-(bromomethyl)-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid (CID 175471571) is 5-(bromomethyl)-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid.
What is the SMILES notation for 5-(bromomethyl)-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid?
The canonical SMILES for 5-(bromomethyl)-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid is CC1(CBr)CC(C(=O)O)=CC=C1F.
What is the InChIKey of 5-(bromomethyl)-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid?
The InChIKey is YOFYDSDGJGHFAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrFO2/c1-9(5-10)4-6(8(12)13)2-3-7(9)11/h2-3H,4-5H2,1H3,(H,12,13).
What are the key properties of 5-(bromomethyl)-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid?
5-(bromomethyl)-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid has a molecular weight of 249.08 g/mol, XLogP of 2.66, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(bromomethyl)-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid is sourced from PubChem (CID 175471571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).