C22H14F8N4O — CID 175471750
(Z)-3-[3,5-bis[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-1-(3,3-difluoroazetidin-1-yl)prop-2-en-1-one (PubChem CID 175471750) has the molecular formula C22H14F8N4O and a molecular weight of 502.37 g/mol. Its IUPAC name is (Z)-3-[3,5-bis[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-1-(3,3-difluoroazetidin-1-yl)prop-2-en-1-one.
| Compound Name | (Z)-3-[3,5-bis[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-1-(3,3-difluoroazetidin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 175471750 |
| Molecular Formula | C22H14F8N4O |
| Molecular Weight | 502.37 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | (Z)-3-[3,5-bis[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-1-(3,3-difluoroazetidin-1-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C\n1nc(-c2ccc(C(F)(F)F)cc2)nc1-c1ccc(C(F)(F)F)cc1)N1CC(F)(F)C1 |
| InChI | InChI=1S/C22H14F8N4O/c23-20(24)11-33(12-20)17(35)9-10-34-19(14-3-7-16(8-4-14)22(28,29)30)31-18(32-34)13-1-5-15(6-2-13)21(25,26)27/h1-10H,11-12H2/b10-9- |
| InChIKey | VIADVQWOCKVUPZ-KTKRTIGZSA-N |
| XLogP | 5.60 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.37 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|