About (2Z)-1-hexoxy-3,7-dimethylocta-2,6-diene
(2Z)-1-hexoxy-3,7-dimethylocta-2,6-diene (PubChem CID 175472632) has the molecular formula C16H30O
and a molecular weight of 238.41 g/mol. Its IUPAC name is (2Z)-1-hexoxy-3,7-dimethylocta-2,6-diene.
Molecular Properties
| Compound Name | (2Z)-1-hexoxy-3,7-dimethylocta-2,6-diene |
| PubChem CID | 175472632 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | (2Z)-1-hexoxy-3,7-dimethylocta-2,6-diene |
| SMILES | CCCCCCOC/C=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C16H30O/c1-5-6-7-8-13-17-14-12-16(4)11-9-10-15(2)3/h10,12H,5-9,11,13-14H2,1-4H3/b16-12- |
| InChIKey | ALGATNJNWIGYPY-VBKFSLOCSA-N |
| XLogP | 5.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-1-hexoxy-3,7-dimethylocta-2,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-1-hexoxy-3,7-dimethylocta-2,6-diene?
The IUPAC name of (2Z)-1-hexoxy-3,7-dimethylocta-2,6-diene (CID 175472632) is (2Z)-1-hexoxy-3,7-dimethylocta-2,6-diene.
What is the SMILES notation for (2Z)-1-hexoxy-3,7-dimethylocta-2,6-diene?
The canonical SMILES for (2Z)-1-hexoxy-3,7-dimethylocta-2,6-diene is CCCCCCOC/C=C(/C)CCC=C(C)C.
What is the InChIKey of (2Z)-1-hexoxy-3,7-dimethylocta-2,6-diene?
The InChIKey is ALGATNJNWIGYPY-VBKFSLOCSA-N. The full InChI is InChI=1S/C16H30O/c1-5-6-7-8-13-17-14-12-16(4)11-9-10-15(2)3/h10,12H,5-9,11,13-14H2,1-4H3/b16-12-.
What are the key properties of (2Z)-1-hexoxy-3,7-dimethylocta-2,6-diene?
(2Z)-1-hexoxy-3,7-dimethylocta-2,6-diene has a molecular weight of 238.41 g/mol, XLogP of 5.28, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-1-hexoxy-3,7-dimethylocta-2,6-diene is sourced from PubChem (CID 175472632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).