About 4-ethenylphenol;1-methylcyclopentene;2-methylprop-2-enoic acid
4-ethenylphenol;1-methylcyclopentene;2-methylprop-2-enoic acid (PubChem CID 175473315) has the molecular formula C18H24O3
and a molecular weight of 288.39 g/mol. Its IUPAC name is 4-ethenylphenol;1-methylcyclopentene;2-methylprop-2-enoic acid.
Molecular Properties
| Compound Name | 4-ethenylphenol;1-methylcyclopentene;2-methylprop-2-enoic acid |
| PubChem CID | 175473315 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 4-ethenylphenol;1-methylcyclopentene;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.C=Cc1ccc(O)cc1.CC1=CCCC1 |
| InChI | InChI=1S/C8H8O.C6H10.C4H6O2/c1-2-7-3-5-8(9)6-4-7;1-6-4-2-3-5-6;1-3(2)4(5)6/h2-6,9H,1H2;4H,2-3,5H2,1H3;1H2,2H3,(H,5,6) |
| InChIKey | FBQOAKPZXXRVQE-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenylphenol;1-methylcyclopentene;2-methylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenylphenol;1-methylcyclopentene;2-methylprop-2-enoic acid?
The IUPAC name of 4-ethenylphenol;1-methylcyclopentene;2-methylprop-2-enoic acid (CID 175473315) is 4-ethenylphenol;1-methylcyclopentene;2-methylprop-2-enoic acid.
What is the SMILES notation for 4-ethenylphenol;1-methylcyclopentene;2-methylprop-2-enoic acid?
The canonical SMILES for 4-ethenylphenol;1-methylcyclopentene;2-methylprop-2-enoic acid is C=C(C)C(=O)O.C=Cc1ccc(O)cc1.CC1=CCCC1.
What is the InChIKey of 4-ethenylphenol;1-methylcyclopentene;2-methylprop-2-enoic acid?
The InChIKey is FBQOAKPZXXRVQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.C6H10.C4H6O2/c1-2-7-3-5-8(9)6-4-7;1-6-4-2-3-5-6;1-3(2)4(5)6/h2-6,9H,1H2;4H,2-3,5H2,1H3;1H2,2H3,(H,5,6).
What are the key properties of 4-ethenylphenol;1-methylcyclopentene;2-methylprop-2-enoic acid?
4-ethenylphenol;1-methylcyclopentene;2-methylprop-2-enoic acid has a molecular weight of 288.39 g/mol, XLogP of 4.80, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenylphenol;1-methylcyclopentene;2-methylprop-2-enoic acid is sourced from PubChem (CID 175473315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).