C6H8F5MoN4-5 — CID 175473652
azanide;molybdenum;1,2,3,4,5-pentafluorobenzene-6-ide (PubChem CID 175473652) has the molecular formula C6H8F5MoN4-5 and a molecular weight of 327.09 g/mol. Its IUPAC name is azanide;molybdenum;1,2,3,4,5-pentafluorobenzene-6-ide.
| Compound Name | azanide;molybdenum;1,2,3,4,5-pentafluorobenzene-6-ide |
|---|---|
| PubChem CID | 175473652 |
| Molecular Formula | C6H8F5MoN4-5 |
| Molecular Weight | 327.09 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | azanide;molybdenum;1,2,3,4,5-pentafluorobenzene-6-ide |
| SMILES | Fc1[c-]c(F)c(F)c(F)c1F.[Mo].[NH2-].[NH2-].[NH2-].[NH2-] |
| InChI | InChI=1S/C6F5.Mo.4H2N/c7-2-1-3(8)5(10)6(11)4(2)9;;;;;/h;;4*1H2/q-1;;4*-1 |
| InChIKey | VNYKZTMRCUUOJB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 134.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.09 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|