C14H25FN2O4 — CID 175473736
tert-butyl (3R)-4-[(2-ethoxy-2-oxoethyl)amino]-3-fluoropiperidine-1-carboxylate (PubChem CID 175473736) has the molecular formula C14H25FN2O4 and a molecular weight of 304.36 g/mol. Its IUPAC name is tert-butyl (3R)-4-[(2-ethoxy-2-oxoethyl)amino]-3-fluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-4-[(2-ethoxy-2-oxoethyl)amino]-3-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 175473736 |
| Molecular Formula | C14H25FN2O4 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | tert-butyl (3R)-4-[(2-ethoxy-2-oxoethyl)amino]-3-fluoropiperidine-1-carboxylate |
| SMILES | CCOC(=O)CNC1CCN(C(=O)OC(C)(C)C)C[C@H]1F |
| InChI | InChI=1S/C14H25FN2O4/c1-5-20-12(18)8-16-11-6-7-17(9-10(11)15)13(19)21-14(2,3)4/h10-11,16H,5-9H2,1-4H3/t10-,11?/m1/s1 |
| InChIKey | UZPGHWLZRDNQLZ-NFJWQWPMSA-N |
| XLogP | 1.49 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |