C8HF13 — CID 175474450
1,3,3,4,4,5,5-heptafluoro-2-(1,1,1,2,3,3-hexafluoropropan-2-yl)cyclopentene (PubChem CID 175474450) has the molecular formula C8HF13 and a molecular weight of 344.07 g/mol. Its IUPAC name is 1,3,3,4,4,5,5-heptafluoro-2-(1,1,1,2,3,3-hexafluoropropan-2-yl)cyclopentene.
| Compound Name | 1,3,3,4,4,5,5-heptafluoro-2-(1,1,1,2,3,3-hexafluoropropan-2-yl)cyclopentene |
|---|---|
| PubChem CID | 175474450 |
| Molecular Formula | C8HF13 |
| Molecular Weight | 344.07 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | 1,3,3,4,4,5,5-heptafluoro-2-(1,1,1,2,3,3-hexafluoropropan-2-yl)cyclopentene |
| SMILES | FC1=C(C(F)(C(F)F)C(F)(F)F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8HF13/c9-2-1(4(12,3(10)11)8(19,20)21)5(13,14)7(17,18)6(2,15)16/h3H |
| InChIKey | SZEKTERHARFTQP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.07 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|