About 3-[amino(dimethoxy)silyl]oxy-2,2-dimethylhexane
3-[amino(dimethoxy)silyl]oxy-2,2-dimethylhexane (PubChem CID 175474612) has the molecular formula C10H25NO3Si
and a molecular weight of 235.40 g/mol. Its IUPAC name is 3-[amino(dimethoxy)silyl]oxy-2,2-dimethylhexane.
Molecular Properties
| Compound Name | 3-[amino(dimethoxy)silyl]oxy-2,2-dimethylhexane |
| PubChem CID | 175474612 |
| Molecular Formula | C10H25NO3Si |
| Molecular Weight | 235.40 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 3-[amino(dimethoxy)silyl]oxy-2,2-dimethylhexane |
| SMILES | CCCC(O[Si](N)(OC)OC)C(C)(C)C |
| InChI | InChI=1S/C10H25NO3Si/c1-7-8-9(10(2,3)4)14-15(11,12-5)13-6/h9H,7-8,11H2,1-6H3 |
| InChIKey | HYHWGEVEXDREIK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-[amino(dimethoxy)silyl]oxy-2,2-dimethylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[amino(dimethoxy)silyl]oxy-2,2-dimethylhexane?
The IUPAC name of 3-[amino(dimethoxy)silyl]oxy-2,2-dimethylhexane (CID 175474612) is 3-[amino(dimethoxy)silyl]oxy-2,2-dimethylhexane.
What is the SMILES notation for 3-[amino(dimethoxy)silyl]oxy-2,2-dimethylhexane?
The canonical SMILES for 3-[amino(dimethoxy)silyl]oxy-2,2-dimethylhexane is CCCC(O[Si](N)(OC)OC)C(C)(C)C.
What is the InChIKey of 3-[amino(dimethoxy)silyl]oxy-2,2-dimethylhexane?
The InChIKey is HYHWGEVEXDREIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H25NO3Si/c1-7-8-9(10(2,3)4)14-15(11,12-5)13-6/h9H,7-8,11H2,1-6H3.
What are the key properties of 3-[amino(dimethoxy)silyl]oxy-2,2-dimethylhexane?
3-[amino(dimethoxy)silyl]oxy-2,2-dimethylhexane has a molecular weight of 235.40 g/mol, XLogP of 1.90, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[amino(dimethoxy)silyl]oxy-2,2-dimethylhexane is sourced from PubChem (CID 175474612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).