About 5-methoxy-1H-imidazole;tribromogold
5-methoxy-1H-imidazole;tribromogold (PubChem CID 175474881) has the molecular formula C4H6AuBr3N2O
and a molecular weight of 534.78 g/mol. Its IUPAC name is 5-methoxy-1H-imidazole;tribromogold.
Molecular Properties
| Compound Name | 5-methoxy-1H-imidazole;tribromogold |
| PubChem CID | 175474881 |
| Molecular Formula | C4H6AuBr3N2O |
| Molecular Weight | 534.78 g/mol |
| Exact Mass | 531.77 |
| IUPAC Name | 5-methoxy-1H-imidazole;tribromogold |
| SMILES | Br[Au](Br)Br.COc1cnc[nH]1 |
| InChI | InChI=1S/C4H6N2O.Au.3BrH/c1-7-4-2-5-3-6-4;;;;/h2-3H,1H3,(H,5,6);;3*1H/q;+3;;;/p-3 |
| InChIKey | ICMIRQRMJOPIHY-UHFFFAOYSA-K |
| XLogP | 2.95 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 534.78 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methoxy-1H-imidazole;tribromogold with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-1H-imidazole;tribromogold?
The IUPAC name of 5-methoxy-1H-imidazole;tribromogold (CID 175474881) is 5-methoxy-1H-imidazole;tribromogold.
What is the SMILES notation for 5-methoxy-1H-imidazole;tribromogold?
The canonical SMILES for 5-methoxy-1H-imidazole;tribromogold is Br[Au](Br)Br.COc1cnc[nH]1.
What is the InChIKey of 5-methoxy-1H-imidazole;tribromogold?
The InChIKey is ICMIRQRMJOPIHY-UHFFFAOYSA-K. The full InChI is InChI=1S/C4H6N2O.Au.3BrH/c1-7-4-2-5-3-6-4;;;;/h2-3H,1H3,(H,5,6);;3*1H/q;+3;;;/p-3.
What are the key properties of 5-methoxy-1H-imidazole;tribromogold?
5-methoxy-1H-imidazole;tribromogold has a molecular weight of 534.78 g/mol, XLogP of 2.95, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-1H-imidazole;tribromogold is sourced from PubChem (CID 175474881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).