About cyclobutyloxymethanediol
cyclobutyloxymethanediol (PubChem CID 175474917) has the molecular formula C5H10O3
and a molecular weight of 118.13 g/mol. Its IUPAC name is cyclobutyloxymethanediol.
Molecular Properties
| Compound Name | cyclobutyloxymethanediol |
| PubChem CID | 175474917 |
| Molecular Formula | C5H10O3 |
| Molecular Weight | 118.13 g/mol |
| Exact Mass | 118.06 |
| IUPAC Name | cyclobutyloxymethanediol |
| SMILES | OC(O)OC1CCC1 |
| InChI | InChI=1S/C5H10O3/c6-5(7)8-4-2-1-3-4/h4-7H,1-3H2 |
| InChIKey | BQEMJDUWFJVIBJ-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.13 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze cyclobutyloxymethanediol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutyloxymethanediol?
The IUPAC name of cyclobutyloxymethanediol (CID 175474917) is cyclobutyloxymethanediol.
What is the SMILES notation for cyclobutyloxymethanediol?
The canonical SMILES for cyclobutyloxymethanediol is OC(O)OC1CCC1.
What is the InChIKey of cyclobutyloxymethanediol?
The InChIKey is BQEMJDUWFJVIBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O3/c6-5(7)8-4-2-1-3-4/h4-7H,1-3H2.
What are the key properties of cyclobutyloxymethanediol?
cyclobutyloxymethanediol has a molecular weight of 118.13 g/mol, XLogP of -0.18, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutyloxymethanediol is sourced from PubChem (CID 175474917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).