About benzamide;bis(2,6-bis(hydroxymethyl)pyridine-4-carboxamide)
benzamide;bis(2,6-bis(hydroxymethyl)pyridine-4-carboxamide) (PubChem CID 175475228) has the molecular formula C23H27N5O7
and a molecular weight of 485.50 g/mol. Its IUPAC name is benzamide;bis(2,6-bis(hydroxymethyl)pyridine-4-carboxamide).
Molecular Properties
| Compound Name | benzamide;bis(2,6-bis(hydroxymethyl)pyridine-4-carboxamide) |
| PubChem CID | 175475228 |
| Molecular Formula | C23H27N5O7 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | benzamide;bis(2,6-bis(hydroxymethyl)pyridine-4-carboxamide) |
| SMILES | NC(=O)c1cc(CO)nc(CO)c1.NC(=O)c1cc(CO)nc(CO)c1.NC(=O)c1ccccc1 |
| InChI | InChI=1S/2C8H10N2O3.C7H7NO/c2*9-8(13)5-1-6(3-11)10-7(2-5)4-12;8-7(9)6-4-2-1-3-5-6/h2*1-2,11-12H,3-4H2,(H2,9,13);1-5H,(H2,8,9) |
| InChIKey | MAPILFXSDSTZQD-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 235.97 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze benzamide;bis(2,6-bis(hydroxymethyl)pyridine-4-carboxamide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamide;bis(2,6-bis(hydroxymethyl)pyridine-4-carboxamide)?
The IUPAC name of benzamide;bis(2,6-bis(hydroxymethyl)pyridine-4-carboxamide) (CID 175475228) is benzamide;bis(2,6-bis(hydroxymethyl)pyridine-4-carboxamide).
What is the SMILES notation for benzamide;bis(2,6-bis(hydroxymethyl)pyridine-4-carboxamide)?
The canonical SMILES for benzamide;bis(2,6-bis(hydroxymethyl)pyridine-4-carboxamide) is NC(=O)c1cc(CO)nc(CO)c1.NC(=O)c1cc(CO)nc(CO)c1.NC(=O)c1ccccc1.
What is the InChIKey of benzamide;bis(2,6-bis(hydroxymethyl)pyridine-4-carboxamide)?
The InChIKey is MAPILFXSDSTZQD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H10N2O3.C7H7NO/c2*9-8(13)5-1-6(3-11)10-7(2-5)4-12;8-7(9)6-4-2-1-3-5-6/h2*1-2,11-12H,3-4H2,(H2,9,13);1-5H,(H2,8,9).
What are the key properties of benzamide;bis(2,6-bis(hydroxymethyl)pyridine-4-carboxamide)?
benzamide;bis(2,6-bis(hydroxymethyl)pyridine-4-carboxamide) has a molecular weight of 485.50 g/mol, XLogP of -0.88, 7 rotatable bonds, 7 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for benzamide;bis(2,6-bis(hydroxymethyl)pyridine-4-carboxamide) is sourced from PubChem (CID 175475228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).