About 1,5-bis(methylamino)cyclohexa-2,4-diene-1-sulfonic acid
1,5-bis(methylamino)cyclohexa-2,4-diene-1-sulfonic acid (PubChem CID 175475779) has the molecular formula C8H14N2O3S
and a molecular weight of 218.28 g/mol. Its IUPAC name is 1,5-bis(methylamino)cyclohexa-2,4-diene-1-sulfonic acid.
Molecular Properties
| Compound Name | 1,5-bis(methylamino)cyclohexa-2,4-diene-1-sulfonic acid |
| PubChem CID | 175475779 |
| Molecular Formula | C8H14N2O3S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 1,5-bis(methylamino)cyclohexa-2,4-diene-1-sulfonic acid |
| SMILES | CNC1=CC=CC(NC)(S(=O)(=O)O)C1 |
| InChI | InChI=1S/C8H14N2O3S/c1-9-7-4-3-5-8(6-7,10-2)14(11,12)13/h3-5,9-10H,6H2,1-2H3,(H,11,12,13) |
| InChIKey | ROIKZVXHQWSSQQ-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1,5-bis(methylamino)cyclohexa-2,4-diene-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-bis(methylamino)cyclohexa-2,4-diene-1-sulfonic acid?
The IUPAC name of 1,5-bis(methylamino)cyclohexa-2,4-diene-1-sulfonic acid (CID 175475779) is 1,5-bis(methylamino)cyclohexa-2,4-diene-1-sulfonic acid.
What is the SMILES notation for 1,5-bis(methylamino)cyclohexa-2,4-diene-1-sulfonic acid?
The canonical SMILES for 1,5-bis(methylamino)cyclohexa-2,4-diene-1-sulfonic acid is CNC1=CC=CC(NC)(S(=O)(=O)O)C1.
What is the InChIKey of 1,5-bis(methylamino)cyclohexa-2,4-diene-1-sulfonic acid?
The InChIKey is ROIKZVXHQWSSQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O3S/c1-9-7-4-3-5-8(6-7,10-2)14(11,12)13/h3-5,9-10H,6H2,1-2H3,(H,11,12,13).
What are the key properties of 1,5-bis(methylamino)cyclohexa-2,4-diene-1-sulfonic acid?
1,5-bis(methylamino)cyclohexa-2,4-diene-1-sulfonic acid has a molecular weight of 218.28 g/mol, XLogP of -0.15, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-bis(methylamino)cyclohexa-2,4-diene-1-sulfonic acid is sourced from PubChem (CID 175475779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).