About [2-benzyl-3-(dimethylamino)morpholin-2-yl]-phenylmethanone;butan-2-one
[2-benzyl-3-(dimethylamino)morpholin-2-yl]-phenylmethanone;butan-2-one (PubChem CID 175475849) has the molecular formula C24H32N2O3
and a molecular weight of 396.53 g/mol. Its IUPAC name is [2-benzyl-3-(dimethylamino)morpholin-2-yl]-phenylmethanone;butan-2-one.
Molecular Properties
| Compound Name | [2-benzyl-3-(dimethylamino)morpholin-2-yl]-phenylmethanone;butan-2-one |
| PubChem CID | 175475849 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | [2-benzyl-3-(dimethylamino)morpholin-2-yl]-phenylmethanone;butan-2-one |
| SMILES | CCC(C)=O.CN(C)C1NCCOC1(Cc1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H24N2O2.C4H8O/c1-22(2)19-20(24-14-13-21-19,15-16-9-5-3-6-10-16)18(23)17-11-7-4-8-12-17;1-3-4(2)5/h3-12,19,21H,13-15H2,1-2H3;3H2,1-2H3 |
| InChIKey | KMAGBMCJLVDACD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-benzyl-3-(dimethylamino)morpholin-2-yl]-phenylmethanone;butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-benzyl-3-(dimethylamino)morpholin-2-yl]-phenylmethanone;butan-2-one?
The IUPAC name of [2-benzyl-3-(dimethylamino)morpholin-2-yl]-phenylmethanone;butan-2-one (CID 175475849) is [2-benzyl-3-(dimethylamino)morpholin-2-yl]-phenylmethanone;butan-2-one.
What is the SMILES notation for [2-benzyl-3-(dimethylamino)morpholin-2-yl]-phenylmethanone;butan-2-one?
The canonical SMILES for [2-benzyl-3-(dimethylamino)morpholin-2-yl]-phenylmethanone;butan-2-one is CCC(C)=O.CN(C)C1NCCOC1(Cc1ccccc1)C(=O)c1ccccc1.
What is the InChIKey of [2-benzyl-3-(dimethylamino)morpholin-2-yl]-phenylmethanone;butan-2-one?
The InChIKey is KMAGBMCJLVDACD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2O2.C4H8O/c1-22(2)19-20(24-14-13-21-19,15-16-9-5-3-6-10-16)18(23)17-11-7-4-8-12-17;1-3-4(2)5/h3-12,19,21H,13-15H2,1-2H3;3H2,1-2H3.
What are the key properties of [2-benzyl-3-(dimethylamino)morpholin-2-yl]-phenylmethanone;butan-2-one?
[2-benzyl-3-(dimethylamino)morpholin-2-yl]-phenylmethanone;butan-2-one has a molecular weight of 396.53 g/mol, XLogP of 3.34, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-benzyl-3-(dimethylamino)morpholin-2-yl]-phenylmethanone;butan-2-one is sourced from PubChem (CID 175475849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).