About 2-[(5-chloro-1,3-benzoxazol-2-yl)amino]ethyl 4-methylbenzenesulfonate
2-[(5-chloro-1,3-benzoxazol-2-yl)amino]ethyl 4-methylbenzenesulfonate (PubChem CID 175476050) has the molecular formula C16H15ClN2O4S
and a molecular weight of 366.83 g/mol. Its IUPAC name is 2-[(5-chloro-1,3-benzoxazol-2-yl)amino]ethyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | 2-[(5-chloro-1,3-benzoxazol-2-yl)amino]ethyl 4-methylbenzenesulfonate |
| PubChem CID | 175476050 |
| Molecular Formula | C16H15ClN2O4S |
| Molecular Weight | 366.83 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 2-[(5-chloro-1,3-benzoxazol-2-yl)amino]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCNc2nc3cc(Cl)ccc3o2)cc1 |
| InChI | InChI=1S/C16H15ClN2O4S/c1-11-2-5-13(6-3-11)24(20,21)22-9-8-18-16-19-14-10-12(17)4-7-15(14)23-16/h2-7,10H,8-9H2,1H3,(H,18,19) |
| InChIKey | ZAFRFDLDUFGQFO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.83 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5-chloro-1,3-benzoxazol-2-yl)amino]ethyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-chloro-1,3-benzoxazol-2-yl)amino]ethyl 4-methylbenzenesulfonate?
The IUPAC name of 2-[(5-chloro-1,3-benzoxazol-2-yl)amino]ethyl 4-methylbenzenesulfonate (CID 175476050) is 2-[(5-chloro-1,3-benzoxazol-2-yl)amino]ethyl 4-methylbenzenesulfonate.
What is the SMILES notation for 2-[(5-chloro-1,3-benzoxazol-2-yl)amino]ethyl 4-methylbenzenesulfonate?
The canonical SMILES for 2-[(5-chloro-1,3-benzoxazol-2-yl)amino]ethyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCCNc2nc3cc(Cl)ccc3o2)cc1.
What is the InChIKey of 2-[(5-chloro-1,3-benzoxazol-2-yl)amino]ethyl 4-methylbenzenesulfonate?
The InChIKey is ZAFRFDLDUFGQFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClN2O4S/c1-11-2-5-13(6-3-11)24(20,21)22-9-8-18-16-19-14-10-12(17)4-7-15(14)23-16/h2-7,10H,8-9H2,1H3,(H,18,19).
What are the key properties of 2-[(5-chloro-1,3-benzoxazol-2-yl)amino]ethyl 4-methylbenzenesulfonate?
2-[(5-chloro-1,3-benzoxazol-2-yl)amino]ethyl 4-methylbenzenesulfonate has a molecular weight of 366.83 g/mol, XLogP of 3.61, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-chloro-1,3-benzoxazol-2-yl)amino]ethyl 4-methylbenzenesulfonate is sourced from PubChem (CID 175476050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).