C18H22BrF3N2O2 — CID 175476410
4-acetamido-N-[1-(4-bromophenyl)-1,2,2-trifluoroethyl]-N-methylcyclohexane-1-carboxamide (PubChem CID 175476410) has the molecular formula C18H22BrF3N2O2 and a molecular weight of 435.28 g/mol. Its IUPAC name is 4-acetamido-N-[1-(4-bromophenyl)-1,2,2-trifluoroethyl]-N-methylcyclohexane-1-carboxamide.
| Compound Name | 4-acetamido-N-[1-(4-bromophenyl)-1,2,2-trifluoroethyl]-N-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 175476410 |
| Molecular Formula | C18H22BrF3N2O2 |
| Molecular Weight | 435.28 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 4-acetamido-N-[1-(4-bromophenyl)-1,2,2-trifluoroethyl]-N-methylcyclohexane-1-carboxamide |
| SMILES | CC(=O)NC1CCC(C(=O)N(C)C(F)(c2ccc(Br)cc2)C(F)F)CC1 |
| InChI | InChI=1S/C18H22BrF3N2O2/c1-11(25)23-15-9-3-12(4-10-15)16(26)24(2)18(22,17(20)21)13-5-7-14(19)8-6-13/h5-8,12,15,17H,3-4,9-10H2,1-2H3,(H,23,25) |
| InChIKey | LMBWSAHAQIPMMX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.28 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|