C17H20BrF3N2O3 — CID 175476423
[4-[[1-(4-bromophenyl)-1,2,2-trifluoroethyl]-methylcarbamoyl]cyclohexyl] carbamate (PubChem CID 175476423) has the molecular formula C17H20BrF3N2O3 and a molecular weight of 437.26 g/mol. Its IUPAC name is [4-[[1-(4-bromophenyl)-1,2,2-trifluoroethyl]-methylcarbamoyl]cyclohexyl] carbamate.
| Compound Name | [4-[[1-(4-bromophenyl)-1,2,2-trifluoroethyl]-methylcarbamoyl]cyclohexyl] carbamate |
|---|---|
| PubChem CID | 175476423 |
| Molecular Formula | C17H20BrF3N2O3 |
| Molecular Weight | 437.26 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | [4-[[1-(4-bromophenyl)-1,2,2-trifluoroethyl]-methylcarbamoyl]cyclohexyl] carbamate |
| SMILES | CN(C(=O)C1CCC(OC(N)=O)CC1)C(F)(c1ccc(Br)cc1)C(F)F |
| InChI | InChI=1S/C17H20BrF3N2O3/c1-23(14(24)10-2-8-13(9-3-10)26-16(22)25)17(21,15(19)20)11-4-6-12(18)7-5-11/h4-7,10,13,15H,2-3,8-9H2,1H3,(H2,22,25) |
| InChIKey | OGOAJHXBGATHLM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.26 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|