C24H17N5S — CID 175476785
2-[[4-[4-(2,3-dimethylanilino)phenyl]-2,1,3-benzothiadiazol-7-yl]methylidene]propanedinitrile (PubChem CID 175476785) has the molecular formula C24H17N5S and a molecular weight of 407.50 g/mol. Its IUPAC name is 2-[[4-[4-(2,3-dimethylanilino)phenyl]-2,1,3-benzothiadiazol-7-yl]methylidene]propanedinitrile.
| Compound Name | 2-[[4-[4-(2,3-dimethylanilino)phenyl]-2,1,3-benzothiadiazol-7-yl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 175476785 |
| Molecular Formula | C24H17N5S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 2-[[4-[4-(2,3-dimethylanilino)phenyl]-2,1,3-benzothiadiazol-7-yl]methylidene]propanedinitrile |
| SMILES | Cc1cccc(Nc2ccc(-c3ccc(C=C(C#N)C#N)c4nsnc34)cc2)c1C |
| InChI | InChI=1S/C24H17N5S/c1-15-4-3-5-22(16(15)2)27-20-9-6-18(7-10-20)21-11-8-19(12-17(13-25)14-26)23-24(21)29-30-28-23/h3-12,27H,1-2H3 |
| InChIKey | PIYUTNAHVLTAEI-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 85.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|