About indolizine;toluene
indolizine;toluene (PubChem CID 175477337) has the molecular formula C15H15N
and a molecular weight of 209.29 g/mol. Its IUPAC name is indolizine;toluene.
Molecular Properties
| Compound Name | indolizine;toluene |
| PubChem CID | 175477337 |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | indolizine;toluene |
| SMILES | Cc1ccccc1.c1ccn2cccc2c1 |
| InChI | InChI=1S/C8H7N.C7H8/c1-2-6-9-7-3-5-8(9)4-1;1-7-5-3-2-4-6-7/h1-7H;2-6H,1H3 |
| InChIKey | IZTZCJIQHGGEJJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 4.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze indolizine;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indolizine;toluene?
The IUPAC name of indolizine;toluene (CID 175477337) is indolizine;toluene.
What is the SMILES notation for indolizine;toluene?
The canonical SMILES for indolizine;toluene is Cc1ccccc1.c1ccn2cccc2c1.
What is the InChIKey of indolizine;toluene?
The InChIKey is IZTZCJIQHGGEJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.C7H8/c1-2-6-9-7-3-5-8(9)4-1;1-7-5-3-2-4-6-7/h1-7H;2-6H,1H3.
What are the key properties of indolizine;toluene?
indolizine;toluene has a molecular weight of 209.29 g/mol, XLogP of 3.93, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for indolizine;toluene is sourced from PubChem (CID 175477337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).