C24H25NO3 — CID 175477527
3,3-diphenylcyclooctyne;3-hydroxypyrrolidine-2,5-dione (PubChem CID 175477527) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is 3,3-diphenylcyclooctyne;3-hydroxypyrrolidine-2,5-dione.
| Compound Name | 3,3-diphenylcyclooctyne;3-hydroxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 175477527 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 3,3-diphenylcyclooctyne;3-hydroxypyrrolidine-2,5-dione |
| SMILES | C1#CC(c2ccccc2)(c2ccccc2)CCCCC1.O=C1CC(O)C(=O)N1 |
| InChI | InChI=1S/C20H20.C4H5NO3/c1-2-10-16-20(17-11-3-1,18-12-6-4-7-13-18)19-14-8-5-9-15-19;6-2-1-3(7)5-4(2)8/h4-9,12-15H,1-3,10,16H2;2,6H,1H2,(H,5,7,8) |
| InChIKey | NRVAKNHVSHZRDI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|