About bicyclo[2.2.1]hept-2-ene;naphthalene
bicyclo[2.2.1]hept-2-ene;naphthalene (PubChem CID 175477679) has the molecular formula C17H18
and a molecular weight of 222.33 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-2-ene;naphthalene.
Molecular Properties
| Compound Name | bicyclo[2.2.1]hept-2-ene;naphthalene |
| PubChem CID | 175477679 |
| Molecular Formula | C17H18 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | bicyclo[2.2.1]hept-2-ene;naphthalene |
| SMILES | C1=CC2CCC1C2.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C7H10/c1-2-6-10-8-4-3-7-9(10)5-1;1-2-7-4-3-6(1)5-7/h1-8H;1-2,6-7H,3-5H2 |
| InChIKey | QIICGVUOGREDRW-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.1]hept-2-ene;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]hept-2-ene;naphthalene?
The IUPAC name of bicyclo[2.2.1]hept-2-ene;naphthalene (CID 175477679) is bicyclo[2.2.1]hept-2-ene;naphthalene.
What is the SMILES notation for bicyclo[2.2.1]hept-2-ene;naphthalene?
The canonical SMILES for bicyclo[2.2.1]hept-2-ene;naphthalene is C1=CC2CCC1C2.c1ccc2ccccc2c1.
What is the InChIKey of bicyclo[2.2.1]hept-2-ene;naphthalene?
The InChIKey is QIICGVUOGREDRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C7H10/c1-2-6-10-8-4-3-7-9(10)5-1;1-2-7-4-3-6(1)5-7/h1-8H;1-2,6-7H,3-5H2.
What are the key properties of bicyclo[2.2.1]hept-2-ene;naphthalene?
bicyclo[2.2.1]hept-2-ene;naphthalene has a molecular weight of 222.33 g/mol, XLogP of 4.81, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]hept-2-ene;naphthalene is sourced from PubChem (CID 175477679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).