About 3-(2,2-difluoroethyl)pyridine-2,5-diamine
3-(2,2-difluoroethyl)pyridine-2,5-diamine (PubChem CID 175477968) has the molecular formula C7H9F2N3
and a molecular weight of 173.17 g/mol. Its IUPAC name is 3-(2,2-difluoroethyl)pyridine-2,5-diamine.
Molecular Properties
| Compound Name | 3-(2,2-difluoroethyl)pyridine-2,5-diamine |
| PubChem CID | 175477968 |
| Molecular Formula | C7H9F2N3 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 3-(2,2-difluoroethyl)pyridine-2,5-diamine |
| SMILES | Nc1cnc(N)c(CC(F)F)c1 |
| InChI | InChI=1S/C7H9F2N3/c8-6(9)2-4-1-5(10)3-12-7(4)11/h1,3,6H,2,10H2,(H2,11,12) |
| InChIKey | JDTQXHYFBDLXCN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2,2-difluoroethyl)pyridine-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-difluoroethyl)pyridine-2,5-diamine?
The IUPAC name of 3-(2,2-difluoroethyl)pyridine-2,5-diamine (CID 175477968) is 3-(2,2-difluoroethyl)pyridine-2,5-diamine.
What is the SMILES notation for 3-(2,2-difluoroethyl)pyridine-2,5-diamine?
The canonical SMILES for 3-(2,2-difluoroethyl)pyridine-2,5-diamine is Nc1cnc(N)c(CC(F)F)c1.
What is the InChIKey of 3-(2,2-difluoroethyl)pyridine-2,5-diamine?
The InChIKey is JDTQXHYFBDLXCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F2N3/c8-6(9)2-4-1-5(10)3-12-7(4)11/h1,3,6H,2,10H2,(H2,11,12).
What are the key properties of 3-(2,2-difluoroethyl)pyridine-2,5-diamine?
3-(2,2-difluoroethyl)pyridine-2,5-diamine has a molecular weight of 173.17 g/mol, XLogP of 1.05, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-difluoroethyl)pyridine-2,5-diamine is sourced from PubChem (CID 175477968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).