C13H10BrF3N4O3 — CID 175477994
[2-[[4-(4-bromo-2,5-difluorophenyl)-5-oxo-1,2,4-triazol-1-yl]methyl]-3-fluoroprop-2-enyl] carbamate (PubChem CID 175477994) has the molecular formula C13H10BrF3N4O3 and a molecular weight of 407.15 g/mol. Its IUPAC name is [2-[[4-(4-bromo-2,5-difluorophenyl)-5-oxo-1,2,4-triazol-1-yl]methyl]-3-fluoroprop-2-enyl] carbamate.
| Compound Name | [2-[[4-(4-bromo-2,5-difluorophenyl)-5-oxo-1,2,4-triazol-1-yl]methyl]-3-fluoroprop-2-enyl] carbamate |
|---|---|
| PubChem CID | 175477994 |
| Molecular Formula | C13H10BrF3N4O3 |
| Molecular Weight | 407.15 g/mol |
| Exact Mass | 405.99 |
| IUPAC Name | [2-[[4-(4-bromo-2,5-difluorophenyl)-5-oxo-1,2,4-triazol-1-yl]methyl]-3-fluoroprop-2-enyl] carbamate |
| SMILES | NC(=O)OCC(=CF)Cn1ncn(-c2cc(F)c(Br)cc2F)c1=O |
| InChI | InChI=1S/C13H10BrF3N4O3/c14-8-1-10(17)11(2-9(8)16)20-6-19-21(13(20)23)4-7(3-15)5-24-12(18)22/h1-3,6H,4-5H2,(H2,18,22) |
| InChIKey | ORDAZSNJIYJRTP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 92.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.15 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|