C10H7BrF3N3O — CID 175478430
8-bromo-2-(1,2,2-trifluoroethylamino)-6H-1,6-naphthyridin-7-one (PubChem CID 175478430) has the molecular formula C10H7BrF3N3O and a molecular weight of 322.08 g/mol. Its IUPAC name is 8-bromo-2-(1,2,2-trifluoroethylamino)-6H-1,6-naphthyridin-7-one.
| Compound Name | 8-bromo-2-(1,2,2-trifluoroethylamino)-6H-1,6-naphthyridin-7-one |
|---|---|
| PubChem CID | 175478430 |
| Molecular Formula | C10H7BrF3N3O |
| Molecular Weight | 322.08 g/mol |
| Exact Mass | 320.97 |
| IUPAC Name | 8-bromo-2-(1,2,2-trifluoroethylamino)-6H-1,6-naphthyridin-7-one |
| SMILES | O=c1[nH]cc2ccc(NC(F)C(F)F)nc2c1Br |
| InChI | InChI=1S/C10H7BrF3N3O/c11-6-7-4(3-15-10(6)18)1-2-5(16-7)17-9(14)8(12)13/h1-3,8-9H,(H,15,18)(H,16,17) |
| InChIKey | ABETVWGDNHUYGF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.08 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|