C14H16O2 — CID 175478748
(4aR)-1,3,4,4a,4b,5,6,8-octahydrophenanthrene-2,7-dione (PubChem CID 175478748) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is (4aR)-1,3,4,4a,4b,5,6,8-octahydrophenanthrene-2,7-dione.
| Compound Name | (4aR)-1,3,4,4a,4b,5,6,8-octahydrophenanthrene-2,7-dione |
|---|---|
| PubChem CID | 175478748 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | (4aR)-1,3,4,4a,4b,5,6,8-octahydrophenanthrene-2,7-dione |
| SMILES | O=C1CCC2C(=CC=C3CC(=O)CC[C@@H]32)C1 |
| InChI | InChI=1S/C14H16O2/c15-11-3-5-13-9(7-11)1-2-10-8-12(16)4-6-14(10)13/h1-2,13-14H,3-8H2/t13-,14?/m0/s1 |
| InChIKey | JACJHGFFCFNZJG-LSLKUGRBSA-N |
| XLogP | 2.59 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |