C19H26N2O3S — CID 175478794
3-[4-(4-aminophenyl)-2,3,5,6-tetramethylanilino]propane-1-sulfonic acid (PubChem CID 175478794) has the molecular formula C19H26N2O3S and a molecular weight of 362.50 g/mol. Its IUPAC name is 3-[4-(4-aminophenyl)-2,3,5,6-tetramethylanilino]propane-1-sulfonic acid.
| Compound Name | 3-[4-(4-aminophenyl)-2,3,5,6-tetramethylanilino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 175478794 |
| Molecular Formula | C19H26N2O3S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 3-[4-(4-aminophenyl)-2,3,5,6-tetramethylanilino]propane-1-sulfonic acid |
| SMILES | Cc1c(C)c(-c2ccc(N)cc2)c(C)c(C)c1NCCCS(=O)(=O)O |
| InChI | InChI=1S/C19H26N2O3S/c1-12-14(3)19(21-10-5-11-25(22,23)24)15(4)13(2)18(12)16-6-8-17(20)9-7-16/h6-9,21H,5,10-11,20H2,1-4H3,(H,22,23,24) |
| InChIKey | RLICEZNSQDYJRQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|