About phenol;2-phenyl-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one
phenol;2-phenyl-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 175478959) has the molecular formula C18H15N3O2
and a molecular weight of 305.34 g/mol. Its IUPAC name is phenol;2-phenyl-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | phenol;2-phenyl-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
| PubChem CID | 175478959 |
| Molecular Formula | C18H15N3O2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | phenol;2-phenyl-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(-c2ccccc2)nc2cc[nH]c12.Oc1ccccc1 |
| InChI | InChI=1S/C12H9N3O.C6H6O/c16-12-10-9(6-7-13-10)14-11(15-12)8-4-2-1-3-5-8;7-6-4-2-1-3-5-6/h1-7,13H,(H,14,15,16);1-5,7H |
| InChIKey | ABILVJREYOSYAN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 81.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze phenol;2-phenyl-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenol;2-phenyl-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one?
The IUPAC name of phenol;2-phenyl-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one (CID 175478959) is phenol;2-phenyl-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one.
What is the SMILES notation for phenol;2-phenyl-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one?
The canonical SMILES for phenol;2-phenyl-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one is O=c1[nH]c(-c2ccccc2)nc2cc[nH]c12.Oc1ccccc1.
What is the InChIKey of phenol;2-phenyl-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one?
The InChIKey is ABILVJREYOSYAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3O.C6H6O/c16-12-10-9(6-7-13-10)14-11(15-12)8-4-2-1-3-5-8;7-6-4-2-1-3-5-6/h1-7,13H,(H,14,15,16);1-5,7H.
What are the key properties of phenol;2-phenyl-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one?
phenol;2-phenyl-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one has a molecular weight of 305.34 g/mol, XLogP of 3.31, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenol;2-phenyl-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one is sourced from PubChem (CID 175478959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).