C21H20F7N3O4S — CID 175479403
6-[5-(2,2-difluoropropoxy)-3-ethylsulfonyl-2-pyridinyl]-1-(1,2,2,3,3-pentafluoropropyl)-3,4-dihydro-1,7-naphthyridin-2-one (PubChem CID 175479403) has the molecular formula C21H20F7N3O4S and a molecular weight of 543.46 g/mol. Its IUPAC name is 6-[5-(2,2-difluoropropoxy)-3-ethylsulfonyl-2-pyridinyl]-1-(1,2,2,3,3-pentafluoropropyl)-3,4-dihydro-1,7-naphthyridin-2-one.
| Compound Name | 6-[5-(2,2-difluoropropoxy)-3-ethylsulfonyl-2-pyridinyl]-1-(1,2,2,3,3-pentafluoropropyl)-3,4-dihydro-1,7-naphthyridin-2-one |
|---|---|
| PubChem CID | 175479403 |
| Molecular Formula | C21H20F7N3O4S |
| Molecular Weight | 543.46 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | 6-[5-(2,2-difluoropropoxy)-3-ethylsulfonyl-2-pyridinyl]-1-(1,2,2,3,3-pentafluoropropyl)-3,4-dihydro-1,7-naphthyridin-2-one |
| SMILES | CCS(=O)(=O)c1cc(OCC(C)(F)F)cnc1-c1cc2c(cn1)N(C(F)C(F)(F)C(F)F)C(=O)CC2 |
| InChI | InChI=1S/C21H20F7N3O4S/c1-3-36(33,34)15-7-12(35-10-20(2,25)26)8-30-17(15)13-6-11-4-5-16(32)31(14(11)9-29-13)19(24)21(27,28)18(22)23/h6-9,18-19H,3-5,10H2,1-2H3 |
| InChIKey | OLSVRKZYEZMBQR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 89.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|